BIOPEP-UWM: Report
| ID | 10206 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 9 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 986.1223 | Monoisotopic mass | 985.5329 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cruz-Chamorro I., Santos-Sánchez G., Bollati C., Bartolomei M., Li J., Arnoldi A., Lammi C. | |
| Title | |
| Hempseed (Cannabis sativa) peptides WVSPLAGRT and IGFLIIWV exert anti-inflammatory activity in the LPS-stimulated human hepatic cell line. J. Agric. Food Chem., 70, 577–583, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptids SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CO)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C45H71N13O12/c1-22(2)17-31(40(65)52-24(5)37(62)51-20-34(61)53-30(13-9-15-49-45(47)48)39(64)57-36(25(6)60)44(69)70)54-41(66)33-14-10-16-58(33)43(68)32(21-59)55-42(67)35(23(3)4)56-38(63)28(46)18-26-19-50-29-12-8-7-11-27(26)29/h7-8,11-12,19,22-25,28,30-33,35-36,50,59-60H,9-10,13-18,20-21,46H2,1-6H3,(H,51,62)(H,52,65)(H,53,61)(H,54,66)(H,55,67)(H,56,63)(H,57,64)(H,69,70)(H4,47,48,49)/t24-,25+,28-,30-,31-,32-,33-,35-,36-/m0/s1 InChIKey=NKYTWSAISGYNAB-XPMGFRCRSA-N |
| Database reference: |