BIOPEP-UWM: Report
| ID | 10207 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 8 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 960.2089 | Monoisotopic mass | 959.5826 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cruz-Chamorro I., Santos-Sánchez G., Bollati C., Bartolomei M., Li J., Arnoldi A., Lammi C. | |
| Title | |
| Hempseed (Cannabis sativa) peptides WVSPLAGRT and IGFLIIWV exert anti-inflammatory activity in the LPS-stimulated human hepatic cell line. J. Agric. Food Chem., 70, 577–583, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptids SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C(C)C)C(=O)O InChI=1S/C51H77N9O9/c1-11-30(8)41(52)48(65)54-27-40(61)55-38(24-33-19-15-14-16-20-33)45(62)56-37(23-28(4)5)46(63)59-44(32(10)13-3)50(67)60-43(31(9)12-2)49(66)57-39(47(64)58-42(29(6)7)51(68)69)25-34-26-53-36-22-18-17-21-35(34)36/h14-22,26,28-32,37-39,41-44,53H,11-13,23-25,27,52H2,1-10H3,(H,54,65)(H,55,61)(H,56,62)(H,57,66)(H,58,64)(H,59,63)(H,60,67)(H,68,69)/t30-,31-,32-,37-,38-,39-,41-,42-,43-,44-/m0/s1 InChIKey=MJORDOLVTASVCE-SLYZAHRVSA-N |
| Database reference: |