BIOPEP-UWM: Report
| ID | 10213 |
| Name | Dipeptidyl peptidase IV (DPPIV) inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 557.7455 | Monoisotopic mass | 557.3236 | |
| IC50 : | 99.68 µM |
|||
| Bibliographic data: | |
| Authors | |
| Pei J., Liu Z., Pan D., Zhao Y., Dang Y., Gao X. | |
| Title | |
| Transport, stability, and in vivo hypoglycemic effect of a broccoli-derived DPP-IV inhibitory peptide VPLVM. J. Agric. Food Chem., 70, 4934–4941, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)O InChI=1S/C26H47N5O6S/c1-14(2)13-18(29-23(33)19-9-8-11-31(19)25(35)20(27)15(3)4)22(32)30-21(16(5)6)24(34)28-17(26(36)37)10-12-38-7/h14-21H,8-13,27H2,1-7H3,(H,28,34)(H,29,33)(H,30,32)(H,36,37)/t17-,18-,19-,20-,21-/m0/s1 InChIKey=WTUQPUDBBBAMBB-UDZSMLTASA-N Antidiabetic peptide according to the BIOPEP-UWM database of bioactive peptides |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10214 |