BIOPEP-UWM: Report
| ID | 10220 |
| Name | Tyrosinase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Tyrosinase (EC 1.14.18.1) | |||
| Number of residues | 3 |
Activity code | tyr |
| Activity : | tyrosinase inhibitor |
|||
| Chemical mass | 425.4765 | Monoisotopic mass | 425.1944 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Feng Y., Wang Z., Chen J., Li H., Wang Y., Ren D.-F. | |
| Title | |
| Separation, identification, and molecular docking of tyrosinase inhibitory peptides from the hydrolysates of defatted walnut (Juglans regia L.) meal. Food Chem., 353, 129471, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C23H27N3O5/c24-18(13-15-5-2-1-3-6-15)22(29)26-12-4-7-20(26)21(28)25-19(23(30)31)14-16-8-10-17(27)11-9-16/h1-3,5-6,8-11,18-20,27H,4,7,12-14,24H2,(H,25,28)(H,30,31)/t18-,19-,20-/m0/s1 InChIKey=ODGNUUUDJONJSC-UFYCRDLUSA-N Activity against monophenolase and diphenolase |
| Database reference: |
| ChEBI: ID 161823 PubChem: CID 145457304 |