BIOPEP-UWM: Report
| ID | 10224 |
| Name | Antithrombotic peptide |
| sequence |
| Function: | |||
| Antithrombotic | |||
| Number of residues | 7 |
Activity code | at |
| Activity : | antithrombotic |
|||
| Chemical mass | 816.9003 | Monoisotopic mass | 816.4440 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Cheng S., Wu D., Liu H., Xu X., Zhu B., Du M. | |
| Title | |
| A comprehensive method to explore inhibitory kinetics and mechanisms of an anticoagulant peptide derived from Crassostrea gigas. Food Sci. Human Wellness, 11, 1491-1499, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C33H60N12O12/c1-16(2)13-22(30(54)42-19(8-6-12-39-33(37)38)28(52)43-21(32(56)57)7-4-5-11-34)44-31(55)23(15-46)45-29(53)20(9-10-25(48)49)41-26(50)17(3)40-27(51)18(35)14-24(36)47/h16-23,46H,4-15,34-35H2,1-3H3,(H2,36,47)(H,40,51)(H,41,50)(H,42,54)(H,43,52)(H,44,55)(H,45,53)(H,48,49)(H,56,57)(H4,37,38,39)/t17-,18-,19-,20-,21-,22-,23-/m0/s1 InChIKey=PTFNVUCWVZEYQV-FQJIPJFPSA-N |
| Database reference: |