BIOPEP-UWM: Report
| ID | 10225 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 369.4134 | Monoisotopic mass | 369.1683 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ma R., Chen Q., Dai Y., Huang Y., Hou Q., Huang Y., Zhong K., Huang Y., Gao H., Bu Q. | |
| Title | |
| Identification of novel antioxidant peptides from sea squirt (Halocynthia roretzi) and its neuroprotective effect in 6-OHDA-induced neurotoxicity. Food Funct., 13, 6008-6021, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C20H23N3O4/c21-16(11-14-7-3-1-4-8-14)19(25)22-13-18(24)23-17(20(26)27)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13,21H2,(H,22,25)(H,23,24)(H,26,27)/t16-,17-/m0/s1 InChIKey=NHCKESBLOMHIIE-IRXDYDNUSA-N Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database; the BIOPEP-UWM database of bioactive peptides (ID 100231); the EROP-Moscow database |
| Database reference: |
| AHTPDB: ID 4557, 4850, 5471 BIOPEP-UWM database of bioactive peptides: ID 10231 ChemSpider: ID 8445918 EPA CompTox: ID DTXSID70437687 EROP-Moscow: ID E25878 PubChem: CID 10270439 SATPdb: ID satpdb14008 |