BIOPEP-UWM: Report
| ID | 10226 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 335.3971 | Monoisotopic mass | 335.1839 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ma R., Chen Q., Dai Y., Huang Y., Hou Q., Huang Y., Zhong K., Huang Y., Gao H., Bu Q. | |
| Title | |
| Identification of novel antioxidant peptides from sea squirt (Halocynthia roretzi) and its neuroprotective effect in 6-OHDA-induced neurotoxicity. Food Funct., 13, 6008-6021, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C17H25N3O4/c1-11(2)8-13(18)16(22)19-10-15(21)20-14(17(23)24)9-12-6-4-3-5-7-12/h3-7,11,13-14H,8-10,18H2,1-2H3,(H,19,22)(H,20,21)(H,23,24)/t13-,14-/m0/s1 InChIKey=KEVYYIMVELOXCT-KBPBESRZSA-N |
| Database reference: |
| CAS: ID 17608-53-6 ChemSpider: ID 5362669 EPA CompTox: ID DTXSID50426392 PubChem: CID 6994674 |