BIOPEP-UWM: Report
| ID | 10231 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 369.4134 | Monoisotopic mass | 369.1683 | |
| IC50 : | 19.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang X., Wang J., Lin Y., Ding Y., Wang Y., Cheng X., Lin Z. | |
| Title | |
| QSAR study on Angiotensin-Converting Enzyme inhibitor oligopeptides based on a novel set of sequence information descriptors. J. Mol. Model., 17, 1599-1606, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C20H23N3O4/c21-16(11-14-7-3-1-4-8-14)19(25)22-13-18(24)23-17(20(26)27)12-15-9-5-2-6-10-15/h1-10,16-17H,11-13,21H2,(H,22,25)(H,23,24)(H,26,27)/t16-,17-/m0/s1 InChIKey=NHCKESBLOMHIIE-IRXDYDNUSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10225) |
| Database reference: |
| AHTPDB: ID 4557, 4850, 5471 BIOPEP-UWM database of bioactive peptides: ID 10225 ChemSpider: ID 8445918 EPA CompTox: ID DTXSID70437687 EROP-Moscow: ID E25878 PubChem: CID 10270439 SATPdb: ID satpdb14008 |