BIOPEP-UWM: Report
| ID | 10232 |
| Name | ACE inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 3 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 414.4968 | Monoisotopic mass | 414.2260 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Terashima M., Oe M., Ogura K., Matsumura S. | |
| Title | |
| Inhibition strength of short peptides derived from an ACE inhibitory peptide. J. Agric. Food Chem., 59, 11234-11237, 2011 | |
| Year | Source |
| 2011 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C22H30N4O4/c1-13(2)10-18(21(28)26-9-5-8-19(26)22(29)30)25-20(27)16(23)11-14-12-24-17-7-4-3-6-15(14)17/h3-4,6-7,12-13,16,18-19,24H,5,8-11,23H2,1-2H3,(H,25,27)(H,29,30)/t16-,18-,19-/m0/s1 InChIKey=GWBWCGITOYODER-WDSOQIARSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10229) |
| Database reference: |
| AHTPDB: ID 2836 BIOPEP-UWM database of bioactive peptides: ID 10229 EROP-Moscow: ID E10374 SATPdb: ID satpdb25845 |