BIOPEP-UWM: Report
| ID | 10235 |
| Name | HMG-CoA reductase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of HMG-CoA reductase (EC 1.1.1.34) | |||
| Number of residues | 3 |
Activity code | HMGi |
| Activity : | HMG-CoA reductase inhibitor |
|||
| Chemical mass | 349.4236 | Monoisotopic mass | 349.1995 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Silva M., Philadelpho B., Santos J., Souza V., Souza C., Santiago V., Silva J., Souza C., Azeredo F.; Castilho M., Cilli E., Ferreira E. | |
| Title | |
| IAF, QGF, and QDF peptides exhibit cholesterol-lowering activity through a Statin-like HMG-CoA reductase regulation mechanism: in silico and in vitro approach. Int. J. Mol. Sci., 22, 11067, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H]([C@H](CC)C)C(=O)N[C@@H](C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O InChI=1S/C18H27N3O4/c1-4-11(2)15(19)17(23)20-12(3)16(22)21-14(18(24)25)10-13-8-6-5-7-9-13/h5-9,11-12,14-15H,4,10,19H2,1-3H3,(H,20,23)(H,21,22)(H,24,25)/t11-,12-,14-,15-/m0/s1 InChIKey=DPTBVFUDCPINIP-JURCDPSOSA-N Inhibitor of Angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the BIOPEP-UWM database of bioactive peptides (ID 10176) |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10176 ChEBI: ID 158152 PubChem: CID 656985 |