BIOPEP-UWM: Report
| ID | 10253 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Stimulating osteoblast differentiation | |||
| Number of residues | 9 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 925.0774 | Monoisotopic mass | 924.5263 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Shanmugam V. P., Kapila S., Sonfack T. K., Kapila R. | |
| Title | |
| Antioxidative peptide derived from enzymatic digestion of buffalo casein. Int. Dairy J., 42, 1-5, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C42H72N10O13/c1-10-21(6)31(48-36(58)27-13-11-15-51(27)40(62)30(20(4)5)47-34(56)22(7)45-35(57)25(43)18-29(44)55)38(60)50-33(24(9)54)41(63)52-16-12-14-28(52)37(59)49-32(23(8)53)39(61)46-26(42(64)65)17-19(2)3/h19-28,30-33,53-54H,10-18,43H2,1-9H3,(H2,44,55)(H,45,57)(H,46,61)(H,47,56)(H,48,58)(H,49,59)(H,50,60)(H,64,65)/t21-,22-,23+,24+,25-,26-,27-,28-,30-,31-,32-,33-/m0/s1 InChIKey=YAYLBBBVDJYVKI-AVIRKOSGSA-N Osteoanabolic peptide according to the BIOPEP-UWM database of bioactive peptides (ID 10250); the MBPDB database |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10250 EROP-Moscow: ID E23870 MBPDB: peptide NAVPITPTL |