BIOPEP-UWM: Report
| ID | 10273 |
| Name | Cathepsin B inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Cathepsin B (EC 3.4.22.1) (MEROPS ID: C01.060) | |||
| Number of residues | 5 |
Activity code | catb |
| Activity : | cathepsin B inhibitor |
|||
| Chemical mass | 529.6269 | Monoisotopic mass | 529.2891 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee H. C., Lee K. J. | |
| Title | |
| Cathepsin B inhibitory peptides derived from beta-casein. Peptides, 21, 807-809, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: NCC(=O)N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)CCC2)Cc2ccccc2)CCC1 InChI=1S/C27H39N5O6/c1-3-17(2)23(27(37)38)30-25(35)21-12-8-14-32(21)26(36)19(15-18-9-5-4-6-10-18)29-24(34)20-11-7-13-31(20)22(33)16-28/h4-6,9-10,17,19-21,23H,3,7-8,11-16,28H2,1-2H3,(H,29,34)(H,30,35)(H,37,38)/t17-,19-,20-,21-,23-/m0/s1 InChIKey: QTNCVVIHEYTVBY-ZXDAYAIVSA-N Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 212) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 212 CBRENDA: Ligand Gly-Pro-Phe-Pro-Ile EROP-Moscow: ID E02218 PepBank: ID GPFPI PubChem: ID 42630509 |