BIOPEP-UWM: Report
| ID | 10275 |
| Name | Dipeptidyl peptidase IV inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 3 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 301.3808 | Monoisotopic mass | 301.1995 | |
| IC50 : | 2220.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Carrera-Alvarado G., Toldrá F., Mora L. | |
| Title | |
| DPP-IV Inhibitory Peptides GPF, IGL, and GGGW Obtained from Chicken Blood Hydrolysates. Int. J. Mol. Sci., 23 (22), 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI= 1S/C14H27N3O4/c1-5-9(4)12(15)13(19)16-7-11(18)17-10(14(20)21)6-8(2)3/h8-10,12H,5-7,15H2,1-4H3,(H,16,19)(H,17,18)(H,20,21)/t9-,10-,12-/m0/s1 InChIKey= NYEYYMLUABXDMC-NHCYSSNCSA-N |
| Database reference: |
| BRENDA: Ligand amyloid beta32-34 ChEBI: ID 158430 PubChem: CID 145456149 |