BIOPEP-UWM: Report
| ID | 10278 |
| Name | Anti-inflammatory peptide |
| sequence |
| Function: | |||
| Anti-inflammatory | |||
| Number of residues | 3 |
Activity code | ai |
| Activity : | anti inflammatory |
|||
| Chemical mass | 404.4590 | Monoisotopic mass | 404.2053 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Fan H., Bhullar K.S., Wang Z., Wu J. | |
| Title | |
| Soybean-Derived Tripeptide Leu–Ser–Trp (LSW) Protects Human Vascular Endothelial Cells from TNFα-Induced Oxidative Stress and Inflammation via Modulating TNFα Receptors and SIRT1. Foods 11 (22), 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)O InChI=1S/C20H28N4O5/c1-11(2)7-14(21)18(26)24-17(10-25)19(27)23-16(20(28)29)8-12-9-22-15-6-4-3-5-13(12)15/h3-6,9,11,14,16-17,22,25H,7-8,10,21H2,1-2H3,(H,23,27)(H,24,26)(H,28,29)/t14-,16-,17-/m0/s1 InChIKey= HWMQRQIFVGEAPH-XIRDDKMYSA-N |
| Database reference: |