BIOPEP-UWM: Report
| ID | 10281 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 9 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 1016.1053 | Monoisotopic mass | 1015.5071 | |
| IC50 : | 67.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Esfandi R., Seidu I., Willmore W., Tsopmo A. | |
| Title | |
| Antioxidant, pancreatic lipase, and α-Amylase inhibitory properties of oat bran hydrolyzed proteins and peptides. J Food Biochem, 46 (4), e13762, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)O InChI=1S/C45H69N13O14/c1-8-22(6)36(58-38(64)27(46)15-32(47)61)44(70)53-29(16-33(48)62)39(65)51-23(7)37(63)52-28(14-25-17-49-19-50-25)40(66)55-31(18-59)41(67)56-35(21(4)5)43(69)57-34(20(2)3)42(68)54-30(45(71)72)13-24-9-11-26(60)12-10-24/h9-12,17,19-23,27-31,34-36,59-60H,8,13-16,18,46H2,1-7H3,(H2,47,61)(H2,48,62)(H,49,50)(H,51,65)(H,52,63)(H,53,70)(H,54,68)(H,55,66)(H,56,67)(H,57,69)(H,58,64)(H,71,72)/t22-,23-,27-,28-,29-,30-,31-,34-,35-,36-/m0/s1 InChIKey= MGSYPOVWNZCQMH-GVVAEISLSA-N |
| Database reference: |