BIOPEP-UWM: Report
| ID | 10284 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 7 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 741.8979 | Monoisotopic mass | 741.3831 | |
| IC50 : | 318.30 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hu S., Fan X., Qi P., Zhang X. | |
| Title | |
| Identification of anti-diabetes peptides from spirulina platensis. J Funct Foods, 56, 333–341, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCSC)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C32H55N9O9S/c1-18(2)26(39-25(43)17-34)31(48)41-14-7-10-23(41)28(45)36-19(11-15-51-3)30(47)40-13-6-9-22(40)29(46)38-21(16-24(35)42)27(44)37-20(32(49)50)8-4-5-12-33/h18-23,26H,4-17,33-34H2,1-3H3,(H2,35,42)(H,36,45)(H,37,44)(H,38,46)(H,39,43)(H,49,50)/t19-,20-,21-,22-,23-,26-/m0/s1 InChIKey= FYMRNRNNJPIYGM-DAESNONBSA-N |
| Database reference: |