BIOPEP-UWM: Report
| ID | 10288 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 3 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 347.3632 | Monoisotopic mass | 347.1686 | |
| IC50 : | 2620.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Admassu H., Gasmalla M. A. A., Yang R., Zhao W. | |
| Title | |
| Identification of bioactive peptides with α-amylase inhibitory potential from enzymatic protein hydrolysates of red seaweed (porphyra spp). J Agric Food Chem, 66 (19), 4872–4882, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CO)C(=O) InChI=1S/C14H25N3O6/c1-8(2)5-11(14(23)16-9(6-18)7-19)17-13(22)10(15)3-4-12(20)21/h6,8-11,19H,3-5,7,15H2,1-2H3,(H,16,23)(H,17,22)(H,20,21)/t9-,10+,11+/m1/s1 InChIKey= GSIBPRJIXLTELX-VWYCJHECSA-N |
| Database reference: |