BIOPEP-UWM: Report
| ID | 10290 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 8 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 843.9653 | Monoisotopic mass | 843.4266 | |
| IC50 : | 15730.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach. Food Chem, 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)NCC(=O)N[C@@]([H])(C)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)O InChI=1S/C43H57N9O9/c1-25(2)19-33(51-40(57)31-15-9-17-44-31)42(59)52-18-10-16-35(52)41(58)50-32(21-28-22-45-30-14-8-7-13-29(28)30)39(56)47-23-36(53)48-26(3)38(55)46-24-37(54)49-34(43(60)61)20-27-11-5-4-6-12-27/h4-8,11-14,22,25-26,31-35,44-45H,9-10,15-21,23-24H2,1-3H3,(H,46,55)(H,47,56)(H,48,53)(H,49,54)(H,50,58)(H,51,57)(H,60,61)/t26-,31-,32-,33-,34-,35-/m0/s1 InChIKey= JKTMFFGJVPSDCW-LEOAUMQFSA-N |
| Database reference: |