BIOPEP-UWM: Report
| ID | 10291 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 8 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 917.1673 | Monoisotopic mass | 916.5188 | |
| IC50 : | 15800.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach. Food Chem, 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C44H72N10O9S/c1-25(2)19-31(50-41(59)35-12-9-16-53(35)42(60)33(20-26(3)4)51-37(55)29-11-8-15-46-29)39(57)49-32(22-28-23-45-24-47-28)40(58)48-30(14-18-64-7)38(56)52-34(21-27(5)6)43(61)54-17-10-13-36(54)44(62)63/h23-27,29-36,46H,8-22H2,1-7H3,(H,45,47)(H,48,58)(H,49,57)(H,50,59)(H,51,55)(H,52,56)(H,62,63)/t29-,30-,31-,32-,33-,34-,35-,36-/m0/s1 InChIKey= RWQLHMHJSSCYMF-VTGDPKQBSA-N |
| Database reference: |