BIOPEP-UWM: Report
| ID | 10293 |
| Name | Alpha-amylase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-amylase (EC 3.2.1.1) | |||
| Number of residues | 6 |
Activity code | aami |
| Activity : | alpha-amylase inhibitor |
|||
| Chemical mass | 690.8529 | Monoisotopic mass | 690.3512 | |
| IC50 : | 23330.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ngoh Y. Y., Gan C. Y. | |
| Title | |
| Identification of pinto bean peptides with inhibitory effects on α-amylase and angiotensin converting enzyme (ACE) activities using an integrated bioinformatics-assisted approach. Food Chem, 267, 124–131, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C32H50N8O7S/c1-19(2)15-24(31(45)40-13-6-9-26(40)32(46)47)38-27(41)21(10-14-48-3)36-28(42)23(16-20-17-33-18-35-20)37-29(43)25-8-5-12-39(25)30(44)22-7-4-11-34-22/h17-19,21-26,34H,4-16H2,1-3H3,(H,33,35)(H,36,42)(H,37,43)(H,38,41)(H,46,47)/t21-,22-,23-,24-,25-,26-/m0/s1 InChIKey= HPDQMSHNSALVNQ-FRSCJGFNSA-N |
| Database reference: |