BIOPEP-UWM: Report
| ID | 10296 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 3 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 318.3287 | Monoisotopic mass | 318.1647 | |
| IC50 : | 20.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Jiang M., Yan H., He R., Ma Y. | |
| Title | |
| Purification and a molecular docking study of α-glucosidase-inhibitory peptides from a soybean protein hydrolysate with ultrasonic pretreatment. European Food Research and Technology, 244 (11), 1995–2005, 2018 | |
| Year | Source |
| 2018 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C11H22N6O5/c12-4-8(19)16-7(5-18)9(20)17-6(10(21)22)2-1-3-15-11(13)14/h6-7,18H,1-5,12H2,(H,16,19)(H,17,20)(H,21,22)(H4,13,14,15)/t6-,7-/m0/s1 InChIKey= YOBGUCWZPXJHTN-BQBZGAKWSA-N |
| Database reference: |