BIOPEP-UWM: Report
| ID | 10297 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 2 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 291.3018 | Monoisotopic mass | 291.1215 | |
| IC50 : | 24.71 µM |
|||
| Bibliographic data: | |
| Authors | |
| Gu X., Gao T., Hou Y., Li D., Fu L. | |
| Title | |
| Identification and characterization of two novel α-glucosidase inhibitory peptides from almond (armeniaca sibirica) oil manufacture residue. LWT, 134, 110215, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CO)C(=O)O InChI=1S/C14H17N3O4/c15-10(13(19)17-12(7-18)14(20)21)5-8-6-16-11-4-2-1-3-9(8)11/h1-4,6,10,12,16,18H,5,7,15H2,(H,17,19)(H,20,21)/t10-,12-/m0/s1 InChIKey= MYVYPSWUSKCCHG-JQWIXIFHSA-N |
| Database reference: |