BIOPEP-UWM: Report
| ID | 10298 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 11 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1179.4036 | Monoisotopic mass | 1178.6678 | |
| IC50 : | 33.93 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao B., Su K., Mao X., Zhang X. | |
| Title | |
| Separation and identification of enzyme inhibition peptides from dark tea protein. Bioorg Chem, 99,103772, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C58H90N12O14/c1-30(2)26-40(65-53(78)43(29-44(71)72)68-57(82)47(33(7)8)70-55(80)45(60)31(3)4)54(79)69-46(32(5)6)56(81)67-42(28-38-22-16-13-17-23-38)52(77)66-41(27-37-20-14-12-15-21-37)51(76)63-35(10)49(74)61-34(9)48(73)62-36(11)50(75)64-39(58(83)84)24-18-19-25-59/h12-17,20-23,30-36,39-43,45-47H,18-19,24-29,59-60H2,1-11H3,(H,61,74)(H,62,73)(H,63,76)(H,64,75)(H,65,78)(H,66,77)(H,67,81)(H,68,82)(H,69,79)(H,70,80)(H,71,72)(H,83,84)/t34-,35-,36-,39-,40-,41-,42-,43-,45-,46-,47-/m0/s1 InChIKey= ZOZZITQVDZZCRX-FLCUPLKCSA-N |
| Database reference: |