BIOPEP-UWM: Report
| ID | 10299 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 9 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1107.2173 | Monoisotopic mass | 1106.5815 | |
| IC50 : | 56.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Qiu L., Deng Z., Zhao C., Xiao T., Weng C., Li J., Zheng, L. | |
| Title | |
| Nutritional composition and proteomic analysis of soft-shelled turtle (pelodiscus sinensis) egg and identification of oligopeptides with alpha-glucosidase inhibitory activity. Food Research International, 145, 110414, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CN=C[NH]1)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C47H78N16O15/c1-23(2)36(43(74)57-28(13-15-35(67)68)40(71)62-37(24(3)4)44(75)59-30(46(77)78)10-7-17-54-47(51)52)61-39(70)27(12-14-34(65)66)56-42(73)32-11-8-18-63(32)45(76)29(9-5-6-16-48)58-41(72)31(20-33(50)64)60-38(69)26(49)19-25-21-53-22-55-25/h21-24,26-32,36-37H,5-20,48-49H2,1-4H3,(H2,50,64)(H,53,55)(H,56,73)(H,57,74)(H,58,72)(H,59,75)(H,60,69)(H,61,70)(H,62,71)(H,65,66)(H,67,68)(H,77,78)(H4,51,52,54)/t26-,27-,28-,29-,30-,31-,32-,36-,37-/m0/s1 InChIKey= JADOXZYPBKHREF-FHOMVUFSSA-N |
| Database reference: |