BIOPEP-UWM: Report
| ID | 10301 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 8 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 787.8559 | Monoisotopic mass | 787.4062 | |
| IC50 : | 109.48 µM |
|||
| Bibliographic data: | |
| Authors | |
| Vilcacundo R., Martínez-Villaluenga C., Hernández-Ledesma B. | |
| Title | |
| Release of dipeptidyl peptidase IV, α-amylase and α-glucosidase inhibitory peptides from quinoa (chenopodium quinoa willd.) during in vitro simulated gastrointestinal digestion. J Funct Foods, 35, 531–539, 2017 | |
| Year | Source |
| 2017 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C33H57N9O13/c1-7-16(4)26(35)32(53)41-20(8-10-22(34)44)30(51)38-17(5)28(49)40-19(9-11-25(47)48)29(50)37-13-23(45)36-14-24(46)39-21(12-15(2)3)31(52)42-27(18(6)43)33(54)55/h15-21,26-27,43H,7-14,35H2,1-6H3,(H2,34,44)(H,36,45)(H,37,50)(H,38,51)(H,39,46)(H,40,49)(H,41,53)(H,42,52)(H,47,48)(H,54,55)/t16-,17-,18+,19-,20-,21-,26-,27-/m0/s1 InChIKey= BFKSEVAHVOKXGQ-DSUNPTELSA-N |
| Database reference: |