BIOPEP-UWM: Report
| ID | 10306 |
| Name | Alkaline phosphatase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Alkaline phosphatase (EC 3.1.3.1) | |||
| Number of residues | 3 |
Activity code | alph |
| Activity : | alkaline phosphatase inhibitor |
|||
| Chemical mass | 279.2911 | Monoisotopic mass | 279.1215 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Goldstein D. J., Harris H. | |
| Title | |
| Human placental alkaline phosphatase differs from that of other species. Nature, 280, 602-605, 1979 | |
| Year | Source |
| 1979 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive pepetides SMILES: N[C@@H](CC1=CC=C(C=C1))C(=O)NCC(=O)NCC(=O)O InChI=1S/C13H17N3O4/c14-10(6-9-4-2-1-3-5-9)13(20)16-7-11(17)15-8-12(18)19/h1-5,10H,6-8,14H2,(H,15,17)(H,16,20)(H,18,19)/t10-/m0/s1 InChIKey=NAXPHWZXEXNDIW-JTQLQIEISA-N Inhibitor of angiotensin-converting enzyme (EC 3.4.15.1) (MEROPS ID: M02-001) according to the AHTPDB database, the BIOPEP-UWM database of bioactive peptides (ID 9195), the BRENDA database, the EROP-Moscow database Bitter peptide according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 20) |
| Database reference: |
| AHTPDB: ID 1061; 4553; 4838; 5200; 5467; 7530 BIOPEP-UWM database of bioactive peptides (ID 9195) BIOPEP-UWM database of sensory peptides and amino acids (ID 20) BRENDA: Ligand Phe-Gly-Gly ChEBI: ID 74714 ChemSpider: ID 134538 EROP-Moscow: ID E09367 PubChem: CID 152644 ZINC: ID ZINC02170022 |