BIOPEP-UWM: Report
| ID | 10307 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 7 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 798.9247 | Monoisotopic mass | 798.4585 | |
| IC50 : | 538.17 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao B., Su K., Mao X., Zhang X. | |
| Title | |
| Separation and identification of enzyme inhibition peptides from dark tea protein. Bioorg Chem, 99,103772, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(O)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C35H62N10O11/c1-17(2)15-23(43-29(50)21(11-12-26(47)48)41-28(49)19(5)40-32(53)27(36)20(6)46)30(51)44-24(16-18(3)4)33(54)45-14-8-10-25(45)31(52)42-22(34(55)56)9-7-13-39-35(37)38/h17-25,27,46H,7-16,36H2,1-6H3,(H,40,53)(H,41,49)(H,42,52)(H,43,50)(H,44,51)(H,47,48)(H,55,56)(H4,37,38,39)/t19-,20+,21-,22-,23-,24-,25-,27-/m0/s1 InChIKey= NYKDNSGJDCVGSW-HVJWLESQSA-N |
| Database reference: |