BIOPEP-UWM: Report
| ID | 10308 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 4 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 441.4775 | Monoisotopic mass | 441.2216 | |
| IC50 : | 560.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhang Y., Wang N., Wang W., Wang J., Zhu Z., Li X. | |
| Title | |
| Molecular mechanisms of novel peptides from silkworm pupae that inhibit α-glucosidase. Peptides (N.Y.), 76, 45–50, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)O InChI=1S/C19H31N5O7/c1-10(25)15(19(30)31)22-16(27)12-4-2-8-23(12)18(29)13-5-3-9-24(13)17(28)11(20)6-7-14(21)26/h10-13,15,25H,2-9,20H2,1H3,(H2,21,26)(H,22,27)(H,30,31)/t10-,11+,12+,13+,15+/m1/s1 InChIKey= MUGMTUFVTXINKB-MCZMQQNQSA-N |
| Database reference: |