BIOPEP-UWM: Report
| ID | 10309 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 7 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 837.0432 | Monoisotopic mass | 836.4677 | |
| IC50 : | 621.27 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhao B., Su K., Mao X., Zhang X. | |
| Title | |
| Separation and identification of enzyme inhibition peptides from dark tea protein. Bioorg Chem, 99,103772, 2020 | |
| Year | Source |
| 2020 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CS)C(=O)NCC(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@]([H])(CCCCN)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C37H64N12O8S/c1-22(2)30(35(55)47-27(36(56)57)15-10-18-43-37(41)42)49-34(54)28(19-23-11-4-3-5-12-23)48-33(53)26(14-7-9-17-39)46-32(52)25(13-6-8-16-38)45-29(50)20-44-31(51)24(40)21-58/h3-5,11-12,22,24-28,30,58H,6-10,13-21,38-40H2,1-2H3,(H,44,51)(H,45,50)(H,46,52)(H,47,55)(H,48,53)(H,49,54)(H,56,57)(H4,41,42,43)/t24-,25-,26-,27-,28-,30-/m0/s1 InChIKey= MIHJLCPQLVWXSN-YUGXLDDKSA-N |
| Database reference: |