BIOPEP-UWM: Report
| ID | 10313 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 10 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 1188.3328 | Monoisotopic mass | 1187.6392 | |
| IC50 : | 112.96 µM |
|||
| Bibliographic data: | |
| Authors | |
| Hu S., Fan X., Qi P., Zhang X. | |
| Title | |
| Identification of anti-diabetes peptides from spirulina platensis. J Funct Foods, 56, 333–341, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C52H85N17O15/c1-25(2)19-31(53)43(76)63-33(13-9-17-58-51(54)55)44(77)68-38(23-70)48(81)64-34(15-16-40(72)73)45(78)67-36(20-26(3)4)46(79)62-27(5)41(74)61-28(6)42(75)66-37(21-29-22-60-32-12-8-7-11-30(29)32)47(80)69-39(24-71)49(82)65-35(50(83)84)14-10-18-59-52(56)57/h7-8,11-12,22,25-28,31,33-39,60,70-71H,9-10,13-21,23-24,53H2,1-6H3,(H,61,74)(H,62,79)(H,63,76)(H,64,81)(H,65,82)(H,66,75)(H,67,78)(H,68,77)(H,69,80)(H,72,73)(H,83,84)(H4,54,55,58)(H4,56,57,59)/t27-,28-,31-,33-,34-,35-,36-,37-,38-,39-/m0/s1 InChIKey= QCJUTOGFUKMYQF-FMPBXAJGSA-N |
| Database reference: |