BIOPEP-UWM: Report
| ID | 10319 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 13 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1384.5582 | Monoisotopic mass | 1383.6907 | |
| IC50 : | 2.20 µM |
|||
| Bibliographic data: | |
| Authors | |
| Thakur S., Chhimwal J., Joshi R., Kumari M., Padwad Y., Kumar R. | |
| Title | |
| Evaluating peptides of picrorhiza kurroa and their inhibitory potential against ACE, DPP-IV, and oxidative stress. J Proteome Res, 20 (8), 3798–3813, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N[C@@]([H])(CO)C(=O)NCC(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CS)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(C(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C57H97N19O19S/c1-27(2)23-35(67-40(78)24-65-46(85)36(25-77)72-44(83)29(5)58)50(89)73-37(26-96)53(92)75-21-9-13-38(75)51(90)70-33(16-18-42(81)82)49(88)68-32(15-17-41(79)80)47(86)66-30(6)45(84)74-43(28(3)4)54(93)76-22-10-14-39(76)52(91)69-31(11-7-19-63-56(59)60)48(87)71-34(55(94)95)12-8-20-64-57(61)62/h27-39,43,77,96H,7-26,58H2,1-6H3,(H,65,85)(H,66,86)(H,67,78)(H,68,88)(H,69,91)(H,70,90)(H,71,87)(H,72,83)(H,73,89)(H,74,84)(H,79,80)(H,81,82)(H,94,95)(H4,59,60,63)(H4,61,62,64)/t29-,30-,31-,32-,33-,34-,35-,36-,37-,38-,39-,43-/m0/s1 InChIKey= WCGDZHPDQFDMKR-NWULDMBASA-N |
| Database reference: |