BIOPEP-UWM: Report
| ID | 10320 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 8 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 986.1206 | Monoisotopic mass | 985.5539 | |
| IC50 : | 8.55 µM |
|||
| Bibliographic data: | |
| Authors | |
| Majid A., Lakshmikanth M., Lokanath N. K., Poornima Priyadarshini C. G. | |
| Title | |
| Generation, characterization and molecular binding mechanism of novel dipeptidyl peptidase-1003 4 inhibitory peptides from sorghum bicolor seed protein. Food Chem, 369, 130888, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(C(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CCCCN)C(=O)O InChI=1S/C42H75N13O14/c1-7-22(6)33(40(67)54-32(21(4)5)39(66)53-27(18-30(57)58)37(64)50-25(41(68)69)11-8-9-15-43)55-38(65)28(19-31(59)60)52-35(62)24(12-10-16-48-42(46)47)49-36(63)26(17-20(2)3)51-34(61)23(44)13-14-29(45)56/h20-28,32-33H,7-19,43-44H2,1-6H3,(H2,45,56)(H,49,63)(H,50,64)(H,51,61)(H,52,62)(H,53,66)(H,54,67)(H,55,65)(H,57,58)(H,59,60)(H,68,69)(H4,46,47,48)/t22-,23-,24-,25-,26-,27-,28-,32-,33-/m0/s1 InChIKey= MIQXFMOJXIFLAF-HFELWZQXSA-N |
| Database reference: |