BIOPEP-UWM: Report
| ID | 10325 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 4 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 464.4679 | Monoisotopic mass | 464.1900 | |
| IC50 : | 40.90 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xiang, X.; Lang, M.; Li, Y.; Zhao, X.; Sun, H.; Jiang, W.; Ni, L.; Song, Y. | |
| Title | |
| Purification, identification and molecular mechanism of dipeptidyl peptidase IV inhibitory peptides from discarded shrimp (penaeus vannamei) head. Journal of Chromatography B, 1186, 122990, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C21H28N4O8/c22-14(10-12-3-5-13(26)6-4-12)20(31)25-9-1-2-16(25)19(30)23-11-17(27)24-15(21(32)33)7-8-18(28)29/h3-6,14-16,26H,1-2,7-11,22H2,(H,23,30)(H,24,27)(H,28,29)(H,32,33)/t14-,15-,16-/m0/s1 InChIKey= PLZFBVRMQLGNSX-JYJNAYRXSA-N |
| Database reference: |