BIOPEP-UWM: Report
| ID | 10326 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 10 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1098.2006 | Monoisotopic mass | 1097.5585 | |
| IC50 : | 42.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lacroix I. M. E., Meng G., Cheung I. W. Y., Li-Chan E. C. Y. | |
| Title | |
| Do whey protein-derived peptides have dual dipeptidyl-peptidase IV and angiotensin I-converting enzyme inhibitory activities? J Funct Foods, 21, 87–96, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(O)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C48H79N11O18/c1-24(2)20-27(50)40(68)54-29(10-6-7-17-49)46(74)58-18-8-12-34(58)45(73)57-39(26(5)60)47(75)59-19-9-11-33(59)44(72)53-28(13-15-36(62)63)41(69)51-23-35(61)52-32(22-38(66)67)43(71)56-31(21-25(3)4)42(70)55-30(48(76)77)14-16-37(64)65/h24-34,39,60H,6-23,49-50H2,1-5H3,(H,51,69)(H,52,61)(H,53,72)(H,54,68)(H,55,70)(H,56,71)(H,57,73)(H,62,63)(H,64,65)(H,66,67)(H,76,77)/t26-,27+,28+,29+,30+,31+,32+,33+,34+,39+/m1/s1 InChIKey= GGFCKAGNOZUZFE-OTRJRROOSA-N |
| Database reference: |