BIOPEP-UWM: Report
| ID | 10329 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 5 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 559.6099 | Monoisotopic mass | 559.2633 | |
| IC50 : | 49.50 µM |
|||
| Bibliographic data: | |
| Authors | |
| Martini S., Solieri L., Cattivelli A., Pizzamiglio V., Tagliazucchi D. | |
| Title | |
| An integrated peptidomics and in silico approach to identify novel anti-diabetic peptides in parmigiano-reggiano cheese. Biology 2021, Vol. 10, Page 563, 10 (6), 563, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCC(=O)O)C(=O)O InChI=1S/C27H37N5O8/c1-16(28)25(37)31-13-5-9-20(31)24(36)30-19(15-17-7-3-2-4-8-17)26(38)32-14-6-10-21(32)23(35)29-18(27(39)40)11-12-22(33)34/h2-4,7-8,16,18-21H,5-6,9-15,28H2,1H3,(H,29,35)(H,30,36)(H,33,34)(H,39,40)/t16-,18-,19-,20-,21-/m0/s1 InChIKey= JVIBCQYJZKRBPW-MQBSTWLZSA-N |
| Database reference: |