BIOPEP-UWM: Report
| ID | 10333 |
| Name | Cathepsin B inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Cathepsin B (EC 3.4.22.1) (MEROPS ID: C01.060) | |||
| Number of residues | 6 |
Activity code | catb |
| Activity : | cathepsin B inhibitor |
|||
| Chemical mass | 626.7418 | Monoisotopic mass | 626.3417 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lee H. C., Lee K. J. | |
| Title | |
| Cathepsin B inhibitory peptides derived from beta-casein. Peptides, 21, 807-809, 2000 | |
| Year | Source |
| 2000 | Journal |
| Additional information: |
| BIOPEP database of sensory peptides and amino acids SMILES: N1[C@H](C(=O)N[C@H](C(=O)N2[C@H](C(=O)NCC(=O)N3[C@H](C(=O)N[C@H](C(=O)O)[C@H](CC)C)CCC3)CCC2)Cc2ccccc2)CCC1 InChI=1S/C32H46N6O7/c1-3-20(2)27(32(44)45)36-30(42)25-14-8-16-37(25)26(39)19-34-29(41)24-13-9-17-38(24)31(43)23(18-21-10-5-4-6-11-21)35-28(40)22-12-7-15-33-22/h4-6,10-11,20,22-25,27,33H,3,7-9,12-19H2,1-2H3,(H,34,41)(H,35,40)(H,36,42)(H,44,45)/t20-,22-,23-,24-,25-,27-/m0/s1 InChIKey: QEZYFJFOYSPYQE-OWNCGHDPSA-N Bitter peptie according to the BIOPEP-UWM database of sensory peptides and amino acids (ID 200) |
| Database reference: |
| BIOPEP-UWM database of sensory peptides and amino acids: ID 200 ChemSpider: ID 8006362 EROP-Moscow: ID E02217 PepBank: ID PFPGPI PubChem: ID 9830628 UNPD: ID UNPD46927 |