BIOPEP-UWM: Report
| ID | 10336 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 13 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 1154.2687 | Monoisotopic mass | 1153.5749 | |
| IC50 : | 65.40 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang T. Y., Hsieh C. H., Hung C. C., Jao C. L., Chen M. C., Hsu K. C. | |
| Title | |
| Fish skin gelatin hydrolysates as dipeptidyl peptidase IV inhibitors and glucagon-like peptide-1 stimulators improve glycaemic control in diabetic rats: A Comparison between Warm- and Cold-Water Fish. J Funct Foods, 19, 330–340, 2015 | |
| Year | Source |
| 2015 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@]([H])(CC(=O)O)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C53H79N13O16/c1-3-30(2)44(54)52(80)66-24-7-14-35(66)45(73)55-26-39(67)59-31(25-43(71)72)49(77)63-21-4-11-32(63)46(74)56-27-40(68)60-18-8-15-36(60)50(78)64-22-5-12-33(64)47(75)57-28-41(69)61-19-9-16-37(61)51(79)65-23-6-13-34(65)48(76)58-29-42(70)62-20-10-17-38(62)53(81)82/h30-38,44H,3-29,54H2,1-2H3,(H,55,73)(H,56,74)(H,57,75)(H,58,76)(H,59,67)(H,71,72)(H,81,82)/t30-,31-,32-,33-,34-,35-,36-,37-,38-,44-/m0/s1 InChIKey= NWHZQBGTABYAIK-RXUMBGRESA-N |
| Database reference: |