BIOPEP-UWM: Report
| ID | 10338 |
| Name | dipeptidyl peptidase IV inhibitor (DPP IV inhibitor) |
| sequence |
| Function: | |||
| Inhibitor of Dipeptidyl Peptidase IV (EC 3.4.14.5) (MEROPS ID: S09.003) | |||
| Number of residues | 10 |
Activity code | dpp |
| Activity : | dipeptidyl peptidase IV inhibitor |
|||
| Chemical mass | 993.1133 | Monoisotopic mass | 992.5064 | |
| IC50 : | 67.12 µM |
|||
| Bibliographic data: | |
| Authors | |
| Wang B., Yu Z., Yokoyama W., Chiou B. sen, Chen M., Liu F., Zhong F. | |
| Title | |
| Collagen peptides with DPP-IV inhibitory activity from sheep skin and their stability to in vitro gastrointestinal digestion. Food Biosci, 42, 101161, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: NCC(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N1[C@@]([H])(CCC1)C(=O)NCC(=O)O InChI=1S/C35H49N9O10/c1-21(40-34(53)26-12-6-13-42(26)28(46)17-36)31(50)38-19-29(47)43-14-5-10-24(43)32(51)37-18-27(45)41-23(16-22-8-3-2-4-9-22)35(54)44-15-7-11-25(44)33(52)39-20-30(48)49/h2-4,8-9,21,23-26H,5-7,10-20,36H2,1H3,(H,37,51)(H,38,50)(H,39,52)(H,40,53)(H,41,45)(H,48,49)/t21-,23-,24-,25-,26-/m0/s1 InChIKey= YRZBBHCGLPBRLM-GKKOWRRISA-N |
| Database reference: |