BIOPEP-UWM: Report
| ID | 10350 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 9 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1402.6725 | Monoisotopic mass | 1401.7657 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lima B., Ricci M., Garro A., Juhász T., Szigýartó I. C., Papp Z. I., Feresin G. et al. | |
| Title | |
| New short cationic antibacterial peptides. Synthesis, biological activity and mechanism of action. BBA - Biomembranes, 1863, 183665, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(CCS(=O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N InChI=1S/C62H99N25O11S/c1-4-33(2)49(87-55(94)44(21-22-48(64)88)81-51(90)38(63)15-9-24-74-59(66)67)58(97)84-43(20-12-27-77-62(72)73)52(91)82-42(19-11-26-76-61(70)71)53(92)85-47(30-35-32-79-40-17-8-6-14-37(35)40)57(96)86-46(29-34-31-78-39-16-7-5-13-36(34)39)56(95)83-45(23-28-99(3)98)54(93)80-41(50(65)89)18-10-25-75-60(68)69/h5-8,13-14,16-17,31-33,38,41-47,49,78-79H,4,9-12,15,18-30,63H2,1-3H3,(H2,64,88)(H2,65,89)(H,80,93)(H,81,90)(H,82,91)(H,83,95)(H,84,97)(H,85,92)(H,86,96)(H,87,94)(H4,66,67,74)(H4,68,69,75)(H4,70,71,76)(H4,72,73,77)/t33-,38-,41-,42-,43-,44-,45-,46-,47-,49-,99?/m0/s1 InChIKey=QWEQBHURMNAADX-PRYPNYHCSA-N Symbol: {M[5O]} means methionine sulfoxide (BIOPEP-UWM repository of amino acids and modifications: ID 99) Symbol: ~ means C-terminal amide group (BIOPEP-UWM repository amino of acids and modifications: ID 75) |
| Database reference: |