BIOPEP-UWM: Report
| ID | 10351 |
| Name | Antibacterial peptide |
| sequence |
| Function: | |||
| Antibacterial | |||
| Number of residues | 9 |
Activity code | ab |
| Activity : | antibacterial |
|||
| Chemical mass | 1297.5356 | Monoisotopic mass | 1296.7080 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Lima B., Ricci M., Garro A., Juhász T., Szigýartó I. C., Papp Z. I., Feresin G. et al. | |
| Title | |
| New short cationic antibacterial peptides. Synthesis, biological activity and mechanism of action. BBA - Biomembranes, 1863, 183665, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCS(=O)C)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)N InChI=1S/C55H92N24O11S/c1-91(90)27-20-37(47(85)72-34(43(58)81)13-5-22-68-53(61)62)75-49(87)41-17-9-26-79(41)51(89)39(28-30-29-71-33-12-3-2-10-31(30)33)77-46(84)35(14-6-23-69-54(63)64)73-45(83)36(15-7-24-70-55(65)66)74-48(86)40-16-8-25-78(40)50(88)38(18-19-42(57)80)76-44(82)32(56)11-4-21-67-52(59)60/h2-3,10,12,29,32,34-41,71H,4-9,11,13-28,56H2,1H3,(H2,57,80)(H2,58,81)(H,72,85)(H,73,83)(H,74,86)(H,75,87)(H,76,82)(H,77,84)(H4,59,60,67)(H4,61,62,68)(H4,63,64,69)(H4,65,66,70)/t32-,34-,35-,36-,37-,38-,39-,40-,41-,91?/m0/s1 InChIKey=AKZGIWHMPAWHDI-KAOZHAIUSA-N Symbol: {M[5O]} means methionine sulfoxide (BIOPEP-UWM repository of amino acids and modifications: ID 99) Symbol: ~ means C-terminal amide group (BIOPEP-UWM repository amino of acids and modifications: ID 75) |
| Database reference: |