BIOPEP-UWM: Report
| ID | 10352 |
| Name | Antiviral peptide |
| sequence |
| Function: | |||
| Inhibitor of HIV-1 retropepsin (EC 3.4.23.16) (MEROPS ID: A02.001) | |||
| Number of residues | 3 |
Activity code | avi |
| Activity : | antiviral |
|||
| Chemical mass | 450.4876 | Monoisotopic mass | 450.2220 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Louis J. M., Dyda F., Nashed N. T., Kimmel A. R., Davies D. R. | |
| Title | |
| Functional characterization of mung bean meal protein-derived antioxidant peptides. Molecules, 26(6), 1515, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCCNC(=N)N)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O InChI=1S/C20H30N6O6/c21-13(8-9-16(27)28)17(29)25-14(7-4-10-24-20(22)23)18(30)26-15(19(31)32)11-12-5-2-1-3-6-12/h1-3,5-6,13-15H,4,7-11,21H2,(H,25,29)(H,26,30)(H,27,28)(H,31,32)(H4,22,23,24)/t13-,14-,15-/m0/s1 InChIKey=LTUVYLVIZHJCOQ-KKUMJFAQSA-N Antioxidative peptide according to the BIOPEP-UWM database of bioactive peptides: ID 10265 |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 10265 BRENDA: Ligand Glu-Arg-Phe ChEBI: ID 162716 PubChem: CID 145455307 |