BIOPEP-UWM: Report
| ID | 10357 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 495.6106 | Monoisotopic mass | 495.3047 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)NCC(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C24H41N5O6/c1-5-14(3)19(25)23(33)29-12-7-9-16(29)21(31)27-20(15(4)6-2)22(32)26-13-18(30)28-11-8-10-17(28)24(34)35/h14-17,19-20H,5-13,25H2,1-4H3,(H,26,32)(H,27,31)(H,34,35)/t14-,15-,16-,17-,19-,20-/m0/s1 InChIKey= KOTSTDBUNSWNHI-BGZMIMFDSA-N |
| Database reference: |