BIOPEP-UWM: Report
| ID | 10358 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 8 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 775.9142 | Monoisotopic mass | 775.3675 | |
| IC50 : | 68.88 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)N[C@@H](CC1=C[NH]C2=CC=CC=C12)C(=O)N[C@@]([H])(C)C(=O)N[C@@]([H])(CS)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(C(C)C)C(=O)NCC(=O)O InChI=1S/C35H53N9O9S/c1-17(2)11-24(33(51)44-29(18(3)4)35(53)39-15-28(46)47)42-34(52)26(16-54)43-31(49)20(6)40-32(50)25(41-27(45)14-38-30(48)19(5)36)12-21-13-37-23-10-8-7-9-22(21)23/h7-10,13,17-20,24-26,29,37,54H,11-12,14-16,36H2,1-6H3,(H,38,48)(H,39,53)(H,40,50)(H,41,45)(H,42,52)(H,43,49)(H,44,51)(H,46,47)/t19-,20-,24-,25-,26-,29-/m0/s1 InChIKey= VLLCOSBFSSHPPP-RCZUOBHBSA-N |
| Database reference: |