BIOPEP-UWM: Report
| ID | 10359 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 5 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 619.7046 | Monoisotopic mass | 619.3206 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Zhu Z., Chen Y., Jia N., Zhang W., Hou H., Xue C., Wang Y. | |
| Title | |
| Identification of three novel antioxidative peptides from Auxenochlorella pyrenoidosa protein hydrolysates based on a peptidomics strategy. Food Chemistry, 375, 131849, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(C)C)C(=O)O InChI=1S/C30H45N5O9/c1-16(2)12-21(26(39)32-22(15-25(37)38)27(40)34-23(30(43)44)13-17(3)4)33-28(41)24-6-5-11-35(24)29(42)20(31)14-18-7-9-19(36)10-8-18/h7-10,16-17,20-24,36H,5-6,11-15,31H2,1-4H3,(H,32,39)(H,33,41)(H,34,40)(H,37,38)(H,43,44)/t20-,21-,22-,23-,24-/m0/s1 InChIKey= DYQASGXEZLWGBT-LSBAASHUSA-N |
| Database reference: |
| BIOPEP-UWM database of bioactive peptides: ID 7556 |