BIOPEP-UWM: Report
| ID | 10361 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 569.7562 | Monoisotopic mass | 569.3236 | |
| IC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Ren Y., Liang K., Jin Y., Zhang M., Chen Y., Wu H., Lai F. | |
| Title | |
| Identification and characterization of two novel α-glucosidase inhibitory oligopeptides from hemp (Cannabis sativa L.) seed protein. Journal of Functional Foods, 26, 439-450, 2016 | |
| Year | Source |
| 2016 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCSC)C(=O)N[C@@]([H])(CC(C)C)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C27H47N5O6S/c1-16(2)14-20(30-23(33)18-8-6-11-28-18)25(35)29-19(10-13-39-5)24(34)31-21(15-17(3)4)26(36)32-12-7-9-22(32)27(37)38/h16-22,28H,6-15H2,1-5H3,(H,29,35)(H,30,33)(H,31,34)(H,37,38)/t18-,19-,20-,21-,22-/m0/s1 InChIKey= UAHGODIDTPOKNA-YFNVTMOMSA-N |
| Database reference: |