BIOPEP-UWM: Report
| ID | 10363 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 506.5540 | Monoisotopic mass | 506.2594 | |
| IC50 : | 8.66 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W., Li H., Wen Y., Liu Y., Wang J., Sun B. | |
| Title | |
| Molecular mechanism for the α-glucosidase inhibitory effect of wheat germ peptides. Journal of Agricultural and Food Chemistry, 69(50), 15231-15239, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(C)C(=O)NCC(=O)NCC(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O I InChI=1S/C22H34N8O6/c1-13(23)19(33)28-11-17(31)27-12-18(32)29-16(10-14-6-3-2-4-7-14)20(34)30-15(21(35)36)8-5-9-26-22(24)25/h2-4,6-7,13,15-16H,5,8-12,23H2,1H3,(H,27,31)(H,28,33)(H,29,32)(H,30,34)(H,35,36)(H4,24,25,26)/t13-,15-,16-/m0/s1 InChIKey= GDHUVPVYKDGICY-BPUTZDHNSA-N |
| Database reference: |