BIOPEP-UWM: Report
| ID | 10364 |
| Name | Alpha-glucosidase inhibitor |
| sequence |
| Function: | |||
| Inhibitor of alpha-glucosidase (EC 3.2.1.20) | |||
| Number of residues | 5 |
Activity code | glui |
| Activity : | alpha-glucosidase inhibitor |
|||
| Chemical mass | 663.7207 | Monoisotopic mass | 663.3330 | |
| IC50 : | 9.21 µM |
|||
| Bibliographic data: | |
| Authors | |
| Liu W., Li H., Wen Y., Liu Y., Wang J., Sun B. | |
| Title | |
| Molecular mechanism for the α-glucosidase inhibitory effect of wheat germ peptides. Journal of Agricultural and Food Chemistry, 69(50), 15231-15239, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CC(=O)O)C(=O)N[C@@]([H])(CC(=O)N)C(=O)N[C@@H](CC1=CC=C(C=C1))C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C29H45N9O9/c1-15(2)11-17(30)24(42)36-21(14-23(40)41)27(45)38-20(13-22(31)39)26(44)37-19(12-16-7-4-3-5-8-16)25(43)35-18(28(46)47)9-6-10-34-29(32)33/h3-5,7-8,15,17-21H,6,9-14,30H2,1-2H3,(H2,31,39)(H,35,43)(H,36,42)(H,37,44)(H,38,45)(H,40,41)(H,46,47)(H4,32,33,34)/t17-,18-,19-,20-,21-/m0/s1 InChIKey= LEFWEBSAZNVJCO-SXYSDOLCSA-N |
| Database reference: |