BIOPEP-UWM: Report
| ID | 10365 |
| Name | ACE Inhibitor |
| sequence |
| Function: | |||
| Inhibitor of Angiotensin-Converting Enzyme (ACE) (EC 3.4.15.1) (MEROPS ID: M02-001) | |||
| Number of residues | 4 |
Activity code | ah |
| Activity : | ACE inhibitor |
|||
| Chemical mass | 469.6163 | Monoisotopic mass | 469.3254 | |
| IC50 : | 355.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Li H., Chen X., Guo Y., Hou T., Hu J. | |
| Title | |
| A pivotal peptide (Ile-Leu-Lys-Pro) with high ACE-inhibitory activity from duck egg white: identification and molecular docking. Food Science and Technology, 42, 2021 | |
| Year | Source |
| 2021 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@]([H])(CC(C)C)C(=O)N[C@@]([H])(CCCCN)C(=O)N1[C@@]([H])(CCC1)C(=O)O InChI=1S/C23H43N5O5/c1-5-15(4)19(25)21(30)27-17(13-14(2)3)20(29)26-16(9-6-7-11-24)22(31)28-12-8-10-18(28)23(32)33/h14-19H,5-13,24-25H2,1-4H3,(H,26,29)(H,27,30)(H,32,33)/t15-,16-,17-,18-,19-/m0/s1 InChIKey= XDCMNYMTCDFMLK-VMXHOPILSA-N |
| Database reference: |