BIOPEP-UWM: Report
| ID | 10370 |
| Name | Immunomodulating peptide |
| sequence |
| Function: | |||
| Immunomodulating | |||
| Number of residues | 6 |
Activity code | im |
| Activity : | immunomodulating |
|||
| Chemical mass | 767.8695 | Monoisotopic mass | 767.3954 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Xu Z., Mao T. M., Huang L., Yu Z. C., Yin B., Chen M.L., Cheng Y.H. | |
| Title | |
| Purification and identification immunomodulatory peptide from rice protein hydrolysates. Food and Agricultural Immunology, 30(1), 150-162, 2019 | |
| Year | Source |
| 2019 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)NCC(=O)N[C@@]([H])([C@]([H])(CC)C)C(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)N1[C@@]([H])(CCC1)C(=O)N[C@@]([H])(CCCNC(=N)N)C(=O)O InChI=1S/C37H53N9O9/c1-3-21(2)31(45-30(49)20-42-32(50)26(38)18-22-8-12-24(47)13-9-22)34(52)44-28(19-23-10-14-25(48)15-11-23)35(53)46-17-5-7-29(46)33(51)43-27(36(54)55)6-4-16-41-37(39)40/h8-15,21,26-29,31,47-48H,3-7,16-20,38H2,1-2H3,(H,42,50)(H,43,51)(H,44,52)(H,45,49)(H,54,55)(H4,39,40,41)/t21-,26-,27-,28-,29-,31-/m0/s1 InChIKey= QJNUVDSAQGVKIC-HHGGTWJGSA-N |
| Database reference: |