BIOPEP-UWM: Report
| ID | 10375 |
| Name | Antioxidative peptide |
| sequence |
| Function: | |||
| Antioxidative | |||
| Number of residues | 3 |
Activity code | ao |
| Activity : | antioxidative |
|||
| Chemical mass | 396.3941 | Monoisotopic mass | 396.1639 | |
| EC50 : | 0.00 µM |
|||
| Bibliographic data: | |
| Authors | |
| Du Z., Wang D., Li Y. | |
| Title | |
| Comprehensive Evaluation and Comparison of Machine Learning Methods in QSAR Modeling of Antioxidant Tripeptides. ACS omega, 7(29), 25760-25771, 2022 | |
| Year | Source |
| 2022 | Journal |
| Additional information: |
| BIOPEP-UWM database of bioactive peptides SMILES: N[C@@H](CC1=CC=C(C=C1)O)C(=O)N[C@@]([H])(CO)C(=O)N[C@@]([H])(CCC(=O)N)C(=O)O InChI=1S/C17H24N4O7/c18-11(7-9-1-3-10(23)4-2-9)15(25)21-13(8-22)16(26)20-12(17(27)28)5-6-14(19)24/h1-4,11-13,22-23H,5-8,18H2,(H2,19,24)(H,20,26)(H,21,25)(H,27,28)/t11-,12-,13-/m0/s1 InChIKey= IEWKKXZRJLTIOV-AVGNSLFASA-N |
| Database reference: |